CAS 162885-01-0 appears in our catalog under these names: (±)–Epibatidine (hydrochloride), (±)-Epibatidine dihydrochloride, (±)-Epibatidine (dihydrochloride). Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 50mg, 25mg, 1 mg, 5 mg.
(1S,2S,4R)-2-(6-chloro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane;dihydrochloride (CAS 162885-01-0) is a chemical compound with the molecular formula C11H15Cl3N2 and a molecular weight of 281.6 g/mol. IUPAC name: (1S,2S,4R)-2-(6-chloro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane;dihydrochloride. InChIKey: DGNNWUINALNROG-YDMPKLSESA-N.
| Molecular formula | C11H15Cl3N2 |
|---|---|
| Molecular weight | 281.6 g/mol |
| IUPAC name | (1S,2S,4R)-2-(6-chloro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane;dihydrochloride |
| InChIKey | DGNNWUINALNROG-YDMPKLSESA-N |
| SMILES | C1C[C@H]2[C@@H](C[C@@H]1N2)C3=CN=C(C=C3)Cl.Cl.Cl |
Computed by PubChem (NCBI)