CAS 1803593-42-1 is the registry number for 1-(2,4-Dichlorophenyl)-1,4-diazepane hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2,4-dichlorophenyl)-1,4-diazepane;hydrochloride (CAS 1803593-42-1) is a chemical compound with the molecular formula C11H15Cl3N2 and a molecular weight of 281.6 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-1,4-diazepane;hydrochloride. InChIKey: OXIVEIGHQILZNI-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl3N2 |
|---|---|
| Molecular weight | 281.6 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-1,4-diazepane;hydrochloride |
| InChIKey | OXIVEIGHQILZNI-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=C(C=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)