CAS 166374-43-2 appears in our catalog under these names: (+)–Epibatidine dihydrochloride, (±)-Epibatidine Dihydrochloride, Epibatidine (dihydrochloride). Offered by: GLPBio, TRC, MedChemExpress. Available pack sizes: 2mg, 100mg, Get quote.
2-(6-chloro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane;dihydrochloride (CAS 166374-43-2) is a chemical compound with the molecular formula C11H15Cl3N2 and a molecular weight of 281.6 g/mol. IUPAC name: 2-(6-chloro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane;dihydrochloride. InChIKey: DGNNWUINALNROG-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl3N2 |
|---|---|
| Molecular weight | 281.6 g/mol |
| IUPAC name | 2-(6-chloro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane;dihydrochloride |
| InChIKey | DGNNWUINALNROG-UHFFFAOYSA-N |
| SMILES | C1CC2C(CC1N2)C3=CN=C(C=C3)Cl.Cl.Cl |
Computed by PubChem (NCBI)