CAS 839712-09-3 is the registry number for 1-(2,3-Dichlorophenyl)-1,4-diazepane hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(2,3-dichlorophenyl)-1,4-diazepane;hydrochloride (CAS 839712-09-3) is a chemical compound with the molecular formula C11H15Cl3N2 and a molecular weight of 281.6 g/mol. IUPAC name: 1-(2,3-dichlorophenyl)-1,4-diazepane;hydrochloride. InChIKey: UCHZHYQSYVASBA-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl3N2 |
|---|---|
| Molecular weight | 281.6 g/mol |
| IUPAC name | 1-(2,3-dichlorophenyl)-1,4-diazepane;hydrochloride |
| InChIKey | UCHZHYQSYVASBA-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=C(C(=CC=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)