Products 1261269-04-8
CAS 1261269-04-8 is the registry number for 3-(1H-imidazol-2-yl)aniline hydrochloride, >95%. Offered by: Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g.
3-(1H-imidazol-2-yl)aniline;hydrochloride (CAS 1261269-04-8) is a chemical compound with the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. IUPAC name: 3-(1H-imidazol-2-yl)aniline;hydrochloride. InChIKey: MYQNJGGSUDCMPX-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3 |
|---|---|
| Molecular weight | 195.65 g/mol |
| IUPAC name | 3-(1H-imidazol-2-yl)aniline;hydrochloride |
| InChIKey | MYQNJGGSUDCMPX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=NC=CN2.Cl |
Computed by PubChem (NCBI)