Products 1261396-65-9
CAS 1261396-65-9 appears in our catalog under these names: Oxcarbazepine-d8, Oxcarbazepine-d8-1. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 1 mg.
1,2,3,4,7,8,9-heptadeuterio-6-oxo-5H-benzo[b][1]benzazepine-11-carboxamide (CAS 1261396-65-9) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 259.31 g/mol. IUPAC name: 1,2,3,4,7,8,9-heptadeuterio-6-oxo-5H-benzo[b][1]benzazepine-11-carboxamide. InChIKey: CTRLABGOLIVAIY-GSNKEKJESA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 259.31 g/mol |
| IUPAC name | 1,2,3,4,7,8,9-heptadeuterio-6-oxo-5H-benzo[b][1]benzazepine-11-carboxamide |
| InChIKey | CTRLABGOLIVAIY-GSNKEKJESA-N |
| SMILES | [2H]C1=C(C(=C2C(=O)CC3=C(C(=C(C(=C3N(C2=C1)C(=O)N)[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)