CAS 1134188-72-9 is the registry number for Oxcarbazepine-D8 (Major). Offered by: TRC. Available pack sizes: 100mg.
1,2,3,4,7,8,9,10-octadeuterio-5-oxo-6H-benzo[b][1]benzazepine-11-carboxamide (CAS 1134188-72-9) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 260.32 g/mol. IUPAC name: 1,2,3,4,7,8,9,10-octadeuterio-5-oxo-6H-benzo[b][1]benzazepine-11-carboxamide. InChIKey: CTRLABGOLIVAIY-PGRXLJNUSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 260.32 g/mol |
| IUPAC name | 1,2,3,4,7,8,9,10-octadeuterio-5-oxo-6H-benzo[b][1]benzazepine-11-carboxamide |
| InChIKey | CTRLABGOLIVAIY-PGRXLJNUSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])CC(=O)C3=C(C(=C(C(=C3N2C(=O)N)[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)