Products 1134188-71-8
CAS 1134188-71-8 appears in our catalog under these names: Oxcarbazepine-d4, Oxcarbazepine–d4, Oxcarbazepine-d4-1. Offered by: Chemat Brand, GLPBio, TargetMol, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 10mg, 1 mg.
1,2,3,4-tetradeuterio-5-oxo-6H-benzo[b][1]benzazepine-11-carboxamide (CAS 1134188-71-8) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 256.29 g/mol. IUPAC name: 1,2,3,4-tetradeuterio-5-oxo-6H-benzo[b][1]benzazepine-11-carboxamide. InChIKey: CTRLABGOLIVAIY-MNYIHESISA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 256.29 g/mol |
| IUPAC name | 1,2,3,4-tetradeuterio-5-oxo-6H-benzo[b][1]benzazepine-11-carboxamide |
| InChIKey | CTRLABGOLIVAIY-MNYIHESISA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=O)CC3=CC=CC=C3N2C(=O)N)[2H])[2H] |
Computed by PubChem (NCBI)