Products 1020719-71-4
CAS 1020719-71-4 appears in our catalog under these names: Oxcarbazepine-D4 (Major), >95% (HPLC), Oxcarbazepine-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg.
1,2,3,4-tetradeuterio-6-oxo-5H-benzo[b][1]benzazepine-11-carboxamide (CAS 1020719-71-4) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 256.29 g/mol. IUPAC name: 1,2,3,4-tetradeuterio-6-oxo-5H-benzo[b][1]benzazepine-11-carboxamide. InChIKey: CTRLABGOLIVAIY-DNZPNURCSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 256.29 g/mol |
| IUPAC name | 1,2,3,4-tetradeuterio-6-oxo-5H-benzo[b][1]benzazepine-11-carboxamide |
| InChIKey | CTRLABGOLIVAIY-DNZPNURCSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])CC(=O)C3=CC=CC=C3N2C(=O)N)[2H])[2H] |
Computed by PubChem (NCBI)