Products 1261396-79-5
CAS 1261396-79-5 appears in our catalog under these names: Hydrochlorothiazide–13C6, Hydrochlorothiazide-13C6, 99.61%, Hydrochlorothiazide-13C6, 99%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 100μg, 100 μg, 1 mg, 1mg.
6-chloro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide (CAS 1261396-79-5) is a chemical compound with the molecular formula C7H8ClN3O4S2 and a molecular weight of 303.7 g/mol. IUPAC name: 6-chloro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide. InChIKey: JZUFKLXOESDKRF-ZRDHQLPYSA-N.
| Molecular formula | C7H8ClN3O4S2 |
|---|---|
| Molecular weight | 303.7 g/mol |
| IUPAC name | 6-chloro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide |
| InChIKey | JZUFKLXOESDKRF-ZRDHQLPYSA-N |
| SMILES | C1N[13C]2=[13CH][13C](=[13C]([13CH]=[13C]2S(=O)(=O)N1)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)