CAS 1423034-39-2 is the registry number for 4-(5-Chlorothiophen-2-yl)-1H-imidazol-2-amine, sulfuric acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(5-chlorothiophen-2-yl)-1H-imidazol-2-amine;sulfuric acid (CAS 1423034-39-2) is a chemical compound with the molecular formula C7H8ClN3O4S2 and a molecular weight of 297.7 g/mol. IUPAC name: 5-(5-chlorothiophen-2-yl)-1H-imidazol-2-amine;sulfuric acid. InChIKey: MOSOKXORRBDSRZ-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O4S2 |
|---|---|
| Molecular weight | 297.7 g/mol |
| IUPAC name | 5-(5-chlorothiophen-2-yl)-1H-imidazol-2-amine;sulfuric acid |
| InChIKey | MOSOKXORRBDSRZ-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Cl)C2=CN=C(N2)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)