CAS 1261524-60-0 is the registry number for 3-Bromo-5-chlorobenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-bromo-5-chlorobenzenesulfonamide (CAS 1261524-60-0) is a chemical compound with the molecular formula C6H5BrClNO2S and a molecular weight of 270.53 g/mol. IUPAC name: 3-bromo-5-chlorobenzenesulfonamide. InChIKey: JGIJYZFOWSNYFA-UHFFFAOYSA-N.
| Molecular formula | C6H5BrClNO2S |
|---|---|
| Molecular weight | 270.53 g/mol |
| IUPAC name | 3-bromo-5-chlorobenzenesulfonamide |
| InChIKey | JGIJYZFOWSNYFA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Br)S(=O)(=O)N |
Computed by PubChem (NCBI)