CAS 1261598-11-1 appears in our catalog under these names: 3-Chloroquinolin-7-ol, 95%, 3–Chloroquinolin–7–ol, 3-Chloroquinolin-7-ol, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
3-chloroquinolin-7-ol (CAS 1261598-11-1) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 3-chloroquinolin-7-ol. InChIKey: IIERDMXICRPOQJ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 3-chloroquinolin-7-ol |
| InChIKey | IIERDMXICRPOQJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC=C(C=C21)Cl)O |
Computed by PubChem (NCBI)