CAS 1261604-08-3 appears in our catalog under these names: 3-(2-Formylphenyl)benzo(d)isoxazole-6-carboxylic acid, 98%, 3–(2–Formylphenyl)benzo(d)isoxazole–6–carboxylic acid, 3-(2-Formylphenyl)benzo[d]isoxazole-6-carboxylic acid, 98%, 98%, 3-(2-Formylphenyl)benzo[d]isoxazole-6-carboxylic acid, 98%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 50mg, 25mg, 100mg, 250mg, 1g.
3-(2-formylphenyl)-1,2-benzoxazole-6-carboxylic acid (CAS 1261604-08-3) is a chemical compound with the molecular formula C15H9NO4 and a molecular weight of 267.24 g/mol. IUPAC name: 3-(2-formylphenyl)-1,2-benzoxazole-6-carboxylic acid. InChIKey: KUGRACLYNAAVSF-UHFFFAOYSA-N.
| Molecular formula | C15H9NO4 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | 3-(2-formylphenyl)-1,2-benzoxazole-6-carboxylic acid |
| InChIKey | KUGRACLYNAAVSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=NOC3=C2C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)