Products 4649-27-8

CAS 4649-27-8 appears in our catalog under these names: 1,3-Dioxo-2-phenylisoindoline-5-carboxylic acid, 95%, 1,3-Dioxo-2-phenylisoindoline-5-carboxylic acid, 95+%, 1,3-Dioxo-2-phenylisoindoline-5-carboxylic acid 95+%, 1,3-Dioxo-2-phenylisoindoline-5-carboxylic acid, 95+%, 95+%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

1,3-dioxo-2-phenylisoindole-5-carboxylic acid (CAS 4649-27-8) is a chemical compound with the molecular formula C15H9NO4 and a molecular weight of 267.24 g/mol. IUPAC name: 1,3-dioxo-2-phenylisoindole-5-carboxylic acid. InChIKey: LJQKDUGNSCMZSJ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H9NO4
Molecular weight267.24 g/mol
IUPAC name1,3-dioxo-2-phenylisoindole-5-carboxylic acid
InChIKeyLJQKDUGNSCMZSJ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O

Computed by PubChem (NCBI)