CAS 41513-78-4 appears in our catalog under these names: N–(2–Carboxyphenyl)phthalimide, 2-(1,3-Dioxoisoindolin-2-yl)benzoic acid 95+%, 2-(1,3-DIOXO-1,3-DIHYDRO-2H-ISOINDOL-2-YL)BENZOIC ACID, 95+%, 95+%, 2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)benzoic acid, 95+%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g.
2-(1,3-dioxoisoindol-2-yl)benzoic acid (CAS 41513-78-4) is a chemical compound with the molecular formula C15H9NO4 and a molecular weight of 267.24 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)benzoic acid. InChIKey: RSKJDIQHYKWJLS-UHFFFAOYSA-N.
| Molecular formula | C15H9NO4 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | 2-(1,3-dioxoisoindol-2-yl)benzoic acid |
| InChIKey | RSKJDIQHYKWJLS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)