CAS 40101-51-7 appears in our catalog under these names: 3-(1,3-Dioxo-1,3-dihydro-isoindol-2-yl)-benzoic acid, 95%, 3-(1,3-Dioxoisoindolin-2-yl)benzoic acid, 97%, 3-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)benzoic acid, 3-(1,3-Dioxoisoindolin-2-yl)benzoic acid 97%, 3-(1,3-Dioxo-1,3-dihydro-isoindol-2-yl)-benzoic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 100mg.
3-(1,3-dioxoisoindol-2-yl)benzoic acid (CAS 40101-51-7) is a chemical compound with the molecular formula C15H9NO4 and a molecular weight of 267.24 g/mol. IUPAC name: 3-(1,3-dioxoisoindol-2-yl)benzoic acid. InChIKey: FGYKYCMETOWTHT-UHFFFAOYSA-N.
| Molecular formula | C15H9NO4 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | 3-(1,3-dioxoisoindol-2-yl)benzoic acid |
| InChIKey | FGYKYCMETOWTHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)