CAS 58585-84-5 appears in our catalog under these names: 2-(Benzoyloxy)-1H-isoindole-1,3(2H)-dione, 97%, 97%, 1,3-Dioxoisoindolin-2-yl benzoate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g.
(1,3-dioxoisoindol-2-yl) benzoate (CAS 58585-84-5) is a chemical compound with the molecular formula C15H9NO4 and a molecular weight of 267.24 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) benzoate. InChIKey: PSXVVEFTUBMHJR-UHFFFAOYSA-N.
| Molecular formula | C15H9NO4 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) benzoate |
| InChIKey | PSXVVEFTUBMHJR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)ON2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)