CAS 1261618-39-6 appears in our catalog under these names: 3,5-Dimethoxybenzene-1-sulfonamide, 95%, 3,5-Dimethoxybenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3,5-dimethoxybenzenesulfonamide (CAS 1261618-39-6) is a chemical compound with the molecular formula C8H11NO4S and a molecular weight of 217.24 g/mol. IUPAC name: 3,5-dimethoxybenzenesulfonamide. InChIKey: SZICDJOKKYGTTC-UHFFFAOYSA-N.
| Molecular formula | C8H11NO4S |
|---|---|
| Molecular weight | 217.24 g/mol |
| IUPAC name | 3,5-dimethoxybenzenesulfonamide |
| InChIKey | SZICDJOKKYGTTC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)S(=O)(=O)N)OC |
Computed by PubChem (NCBI)