Products 685861-79-4

CAS 685861-79-4 is the registry number for (2,4-Dioxo-3-propyl-1,3-thiazolidin-5-yl)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-yl)acetic acid (CAS 685861-79-4) is a chemical compound with the molecular formula C8H11NO4S and a molecular weight of 217.24 g/mol. IUPAC name: 2-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-yl)acetic acid. InChIKey: FLOYFTUBCQWIAC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11NO4S
Molecular weight217.24 g/mol
IUPAC name2-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-yl)acetic acid
InChIKeyFLOYFTUBCQWIAC-UHFFFAOYSA-N
SMILESCCCN1C(=O)C(SC1=O)CC(=O)O

Computed by PubChem (NCBI)