CAS 6471-78-9 appears in our catalog under these names: 4-Amino-5-Methoxy-2-Toluenesulfonic Acid, 4-Amino-5-methoxy-2-methylbenzenesulfonic Acid, >95% (HPLC), 4–Amino–5–methoxy–2–methylbenzensulfonic acid, 4-Amino-5-methoxy-2-methylbenzenesulfonic acid, 4-Amino-5-methoxy-2-methylbenzenesulfonic acid 97%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 1g, 500mg, 5g, 25g, 0,25kg, 0,1kg, 0,5kg.
4-amino-5-methoxy-2-methylbenzenesulfonic acid (CAS 6471-78-9) is a chemical compound with the molecular formula C8H11NO4S and a molecular weight of 217.24 g/mol. IUPAC name: 4-amino-5-methoxy-2-methylbenzenesulfonic acid. InChIKey: JBAVAJIXZVRJHT-UHFFFAOYSA-N.
| Molecular formula | C8H11NO4S |
|---|---|
| Molecular weight | 217.24 g/mol |
| IUPAC name | 4-amino-5-methoxy-2-methylbenzenesulfonic acid |
| InChIKey | JBAVAJIXZVRJHT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1S(=O)(=O)O)OC)N |
Computed by PubChem (NCBI)