Products 921927-99-3

CAS 921927-99-3 is the registry number for Methyl 2-(dimethoxymethyl)-1,3-thiazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2-(dimethoxymethyl)-1,3-thiazole-4-carboxylate (CAS 921927-99-3) is a chemical compound with the molecular formula C8H11NO4S and a molecular weight of 217.24 g/mol. IUPAC name: methyl 2-(dimethoxymethyl)-1,3-thiazole-4-carboxylate. InChIKey: XLOVIYHHLAAFFF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11NO4S
Molecular weight217.24 g/mol
IUPAC namemethyl 2-(dimethoxymethyl)-1,3-thiazole-4-carboxylate
InChIKeyXLOVIYHHLAAFFF-UHFFFAOYSA-N
SMILESCOC(C1=NC(=CS1)C(=O)OC)OC

Computed by PubChem (NCBI)