CAS 19116-90-6 appears in our catalog under these names: 2,5-Dimethoxybenzenesulfonamide, 97%, 2,5-Dimethoxybenzenesulfonamide. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
2,5-dimethoxybenzenesulfonamide (CAS 19116-90-6) is a chemical compound with the molecular formula C8H11NO4S and a molecular weight of 217.24 g/mol. IUPAC name: 2,5-dimethoxybenzenesulfonamide. InChIKey: MMHMYFWOECSGDR-UHFFFAOYSA-N.
| Molecular formula | C8H11NO4S |
|---|---|
| Molecular weight | 217.24 g/mol |
| IUPAC name | 2,5-dimethoxybenzenesulfonamide |
| InChIKey | MMHMYFWOECSGDR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)S(=O)(=O)N |
Computed by PubChem (NCBI)