CAS 1261619-24-2 is the registry number for Hydrochlorothiazide Impurity 25. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-2-chlorobenzenesulfonyl chloride (CAS 1261619-24-2) is a chemical compound with the molecular formula C6H5Cl2NO2S and a molecular weight of 226.08 g/mol. IUPAC name: 4-amino-2-chlorobenzenesulfonyl chloride. InChIKey: RPYMJFHKPUERAX-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO2S |
|---|---|
| Molecular weight | 226.08 g/mol |
| IUPAC name | 4-amino-2-chlorobenzenesulfonyl chloride |
| InChIKey | RPYMJFHKPUERAX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)