Products 1261646-30-3

CAS 1261646-30-3 appears in our catalog under these names: 3–Methoxy–4–nitrobenzene–1–sulfonyl chloride, 3-Methoxy-4-nitrobenzene-1-sulfonyl chloride, 3-Methoxy-4-nitrobenzene-1-sulfonyl chloride 95%, 3-Methoxy-4-nitrobenzene-1-sulfonyl chloride, 98%, 3-Methoxy-4-nitrobenzene-1-sulfonyl chloride, 98%, 98%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 5g, 0,5g, 250mg, 1g, 10g.

Structural formula: {0} (CAS {1})

3-methoxy-4-nitrobenzenesulfonyl chloride (CAS 1261646-30-3) is a chemical compound with the molecular formula C7H6ClNO5S and a molecular weight of 251.64 g/mol. IUPAC name: 3-methoxy-4-nitrobenzenesulfonyl chloride. InChIKey: PCZLTYVOXRKVCM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6ClNO5S
Molecular weight251.64 g/mol
IUPAC name3-methoxy-4-nitrobenzenesulfonyl chloride
InChIKeyPCZLTYVOXRKVCM-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)S(=O)(=O)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)