CAS 1423025-92-6 appears in our catalog under these names: 4-Hydroxy-2-methyl-5-nitrobenzene-1-sulfonyl chloride, 95%, 4-Hydroxy-2-methyl-5-nitrobenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-hydroxy-2-methyl-5-nitrobenzenesulfonyl chloride (CAS 1423025-92-6) is a chemical compound with the molecular formula C7H6ClNO5S and a molecular weight of 251.64 g/mol. IUPAC name: 4-hydroxy-2-methyl-5-nitrobenzenesulfonyl chloride. InChIKey: XIDSCCOEXACQPJ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO5S |
|---|---|
| Molecular weight | 251.64 g/mol |
| IUPAC name | 4-hydroxy-2-methyl-5-nitrobenzenesulfonyl chloride |
| InChIKey | XIDSCCOEXACQPJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1S(=O)(=O)Cl)[N+](=O)[O-])O |
Computed by PubChem (NCBI)