Products 1423025-92-6

CAS 1423025-92-6 appears in our catalog under these names: 4-Hydroxy-2-methyl-5-nitrobenzene-1-sulfonyl chloride, 95%, 4-Hydroxy-2-methyl-5-nitrobenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

4-hydroxy-2-methyl-5-nitrobenzenesulfonyl chloride (CAS 1423025-92-6) is a chemical compound with the molecular formula C7H6ClNO5S and a molecular weight of 251.64 g/mol. IUPAC name: 4-hydroxy-2-methyl-5-nitrobenzenesulfonyl chloride. InChIKey: XIDSCCOEXACQPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6ClNO5S
Molecular weight251.64 g/mol
IUPAC name4-hydroxy-2-methyl-5-nitrobenzenesulfonyl chloride
InChIKeyXIDSCCOEXACQPJ-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1S(=O)(=O)Cl)[N+](=O)[O-])O

Computed by PubChem (NCBI)