CAS 81118-92-5 is the registry number for 2-Methoxy-5-nitrobenzene-1-sulfonyl chloride, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g.
2-methoxy-5-nitrobenzenesulfonyl chloride (CAS 81118-92-5) is a chemical compound with the molecular formula C7H6ClNO5S and a molecular weight of 251.64 g/mol. IUPAC name: 2-methoxy-5-nitrobenzenesulfonyl chloride. InChIKey: DSSUHBJSDMHACJ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO5S |
|---|---|
| Molecular weight | 251.64 g/mol |
| IUPAC name | 2-methoxy-5-nitrobenzenesulfonyl chloride |
| InChIKey | DSSUHBJSDMHACJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)Cl |
Computed by PubChem (NCBI)