CAS 22117-79-9 appears in our catalog under these names: 4-Methoxy-3-nitro-benzenesulfonyl chloride, 96%, 4-Methoxy-3-nitrobenzene-1-sulfonyl chloride, 98%, 98%, 4-Methoxy-3-nitrobenzene-1-sulfonyl chloride, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg, 25g.
4-methoxy-3-nitrobenzenesulfonyl chloride (CAS 22117-79-9) is a chemical compound with the molecular formula C7H6ClNO5S and a molecular weight of 251.64 g/mol. IUPAC name: 4-methoxy-3-nitrobenzenesulfonyl chloride. InChIKey: PWYNJONRUFAOFG-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO5S |
|---|---|
| Molecular weight | 251.64 g/mol |
| IUPAC name | 4-methoxy-3-nitrobenzenesulfonyl chloride |
| InChIKey | PWYNJONRUFAOFG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)