Products 18092-54-1

CAS 18092-54-1 appears in our catalog under these names: 4-Methoxy-2-nitrobenzenesulfonyl chloride, 98%, 4-Methoxy-2-nitrobenzenesulfonyl Chloride, >93.0%(GC)(T), 4-Methoxy-2-nitrobenzenesulfonyl chloride 98%, 4-Methoxy-2-nitrobenzenesulfonyl chloride, 98%, 98%, 4-Methoxy-2-nitrobenzenesulfonyl chloride, 95%. Offered by: Combi-blocks, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-methoxy-2-nitrobenzenesulfonyl chloride (CAS 18092-54-1) is a chemical compound with the molecular formula C7H6ClNO5S and a molecular weight of 251.64 g/mol. IUPAC name: 4-methoxy-2-nitrobenzenesulfonyl chloride. InChIKey: OGHAPVZVXLHURO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6ClNO5S
Molecular weight251.64 g/mol
IUPAC name4-methoxy-2-nitrobenzenesulfonyl chloride
InChIKeyOGHAPVZVXLHURO-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)S(=O)(=O)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)