CAS 1261682-35-2 is the registry number for (5-Iodo-2-(trifluoromethyl)phenyl)methanol, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
[5-iodo-2-(trifluoromethyl)phenyl]methanol (CAS 1261682-35-2) is a chemical compound with the molecular formula C8H6F3IO and a molecular weight of 302.03 g/mol. IUPAC name: [5-iodo-2-(trifluoromethyl)phenyl]methanol. InChIKey: FIBOOUCFALSAIR-UHFFFAOYSA-N.
| Molecular formula | C8H6F3IO |
|---|---|
| Molecular weight | 302.03 g/mol |
| IUPAC name | [5-iodo-2-(trifluoromethyl)phenyl]methanol |
| InChIKey | FIBOOUCFALSAIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)CO)C(F)(F)F |
Computed by PubChem (NCBI)