Products 1261764-39-9
CAS 1261764-39-9 appears in our catalog under these names: 2-Methyl-3-(trifluoromethoxy)benzoic acid, 95%, 2-Methyl-3-(trifluoromethoxy)benzoic acid, 2-METHYL-3-(TRIFLUOROMETHOXY)BENZOIC ACID, 98%, 98%, 2-METHYL-3-(TRIFLUOROMETHOXY)BENZOIC ACID, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
2-methyl-3-(trifluoromethoxy)benzoic acid (CAS 1261764-39-9) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 2-methyl-3-(trifluoromethoxy)benzoic acid. InChIKey: RUHZYHRNERFCLT-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 2-methyl-3-(trifluoromethoxy)benzoic acid |
| InChIKey | RUHZYHRNERFCLT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)