CAS 1261851-55-1 appears in our catalog under these names: 2-(4-(Difluoromethoxy)-3-fluorophenyl)acetic Acid, >95% (HPLC), 2-(4-(Difluoromethoxy)-3-fluorophenyl)acetic acid, 98+%, 2-(4-(Difluoromethoxy)-3-fluorophenyl)acetic acid. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 100mg, 500mg, 50mg, 10g, 5g, 0,5g.
2-[4-(difluoromethoxy)-3-fluorophenyl]acetic acid (CAS 1261851-55-1) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 2-[4-(difluoromethoxy)-3-fluorophenyl]acetic acid. InChIKey: VHFMSYGWFHDRBD-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 2-[4-(difluoromethoxy)-3-fluorophenyl]acetic acid |
| InChIKey | VHFMSYGWFHDRBD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)F)OC(F)F |
Computed by PubChem (NCBI)