Products 1261862-61-6
CAS 1261862-61-6 is the registry number for ethyl 2-(5-bromo-2-cyanophenyl)acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-(5-bromo-2-cyanophenyl)acetate (CAS 1261862-61-6) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: ethyl 2-(5-bromo-2-cyanophenyl)acetate. InChIKey: MHAIHTGVXWVGGA-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | ethyl 2-(5-bromo-2-cyanophenyl)acetate |
| InChIKey | MHAIHTGVXWVGGA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(C=CC(=C1)Br)C#N |
Computed by PubChem (NCBI)
Synonyms:
Ethyl 2-(5-bromo-2-cyanophenyl)acetate