CAS 1261889-77-3 is the registry number for 4'-Chloro-3-hydroxy-2'-methoxy(1,1'-biphenyl)-4-carbonitrile. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
4-(4-chloro-2-methoxyphenyl)-2-hydroxybenzonitrile (CAS 1261889-77-3) is a chemical compound with the molecular formula C14H10ClNO2 and a molecular weight of 259.69 g/mol. IUPAC name: 4-(4-chloro-2-methoxyphenyl)-2-hydroxybenzonitrile. InChIKey: FQPZXRUBEBYBNB-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO2 |
|---|---|
| Molecular weight | 259.69 g/mol |
| IUPAC name | 4-(4-chloro-2-methoxyphenyl)-2-hydroxybenzonitrile |
| InChIKey | FQPZXRUBEBYBNB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Cl)C2=CC(=C(C=C2)C#N)O |
Computed by PubChem (NCBI)