Products 1261892-57-2

CAS 1261892-57-2 is the registry number for 4-(4-Hydroxyphenyl)-2-methoxybenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

4-(4-hydroxyphenyl)-2-methoxybenzoic acid (CAS 1261892-57-2) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: 4-(4-hydroxyphenyl)-2-methoxybenzoic acid. InChIKey: IVLMALSELBEMCC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12O4
Molecular weight244.24 g/mol
IUPAC name4-(4-hydroxyphenyl)-2-methoxybenzoic acid
InChIKeyIVLMALSELBEMCC-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)C2=CC=C(C=C2)O)C(=O)O

Computed by PubChem (NCBI)