CAS 1261899-32-4 is the registry number for 2-Chloro-4-(4-methoxycarbonylphenyl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 4-(3-chloro-4-hydroxyphenyl)benzoate (CAS 1261899-32-4) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: methyl 4-(3-chloro-4-hydroxyphenyl)benzoate. InChIKey: DIDHAEBKDLTMKI-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO3 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | methyl 4-(3-chloro-4-hydroxyphenyl)benzoate |
| InChIKey | DIDHAEBKDLTMKI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC(=C(C=C2)O)Cl |
Computed by PubChem (NCBI)