CAS 1261937-41-0 is the registry number for 3-(4-BOC-Aminophenyl)picolinic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]pyridine-2-carboxylic acid (CAS 1261937-41-0) is a chemical compound with the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. IUPAC name: 3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]pyridine-2-carboxylic acid. InChIKey: PGGVCDIQGVFMLF-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O4 |
|---|---|
| Molecular weight | 314.34 g/mol |
| IUPAC name | 3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]pyridine-2-carboxylic acid |
| InChIKey | PGGVCDIQGVFMLF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)C2=C(N=CC=C2)C(=O)O |
Computed by PubChem (NCBI)