CAS 883291-42-7 is the registry number for Dimethyl 4-(3-aminophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Dimethyl 4-(3-aminophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate (CAS 883291-42-7) is a chemical compound with the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. IUPAC name: dimethyl 4-(3-aminophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate. InChIKey: LAALBRWVLGNBEQ-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O4 |
|---|---|
| Molecular weight | 314.34 g/mol |
| IUPAC name | dimethyl 4-(3-aminophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate |
| InChIKey | LAALBRWVLGNBEQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)C)C(=O)OC)C2=CC(=CC=C2)N)C(=O)OC |
Computed by PubChem (NCBI)