CAS 2245971-39-3 is the registry number for 5-(tert-Butyl)-2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-tert-butyl-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 2245971-39-3) is a chemical compound with the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. IUPAC name: 5-tert-butyl-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: WUBCXLCODKFGID-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O4 |
|---|---|
| Molecular weight | 314.34 g/mol |
| IUPAC name | 5-tert-butyl-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | WUBCXLCODKFGID-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)C(=O)N(C2=O)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)