CAS 880062-11-3 is the registry number for Methyl N-benzoyl-N-(3-formyl-2,5-dimethyl-1H-pyrrol-1-yl)glycinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[benzoyl-(3-formyl-2,5-dimethylpyrrol-1-yl)amino]acetate (CAS 880062-11-3) is a chemical compound with the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. IUPAC name: methyl 2-[benzoyl-(3-formyl-2,5-dimethylpyrrol-1-yl)amino]acetate. InChIKey: UTJMXEXJEZNMOH-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O4 |
|---|---|
| Molecular weight | 314.34 g/mol |
| IUPAC name | methyl 2-[benzoyl-(3-formyl-2,5-dimethylpyrrol-1-yl)amino]acetate |
| InChIKey | UTJMXEXJEZNMOH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1N(CC(=O)OC)C(=O)C2=CC=CC=C2)C)C=O |
Computed by PubChem (NCBI)