Products 887407-34-3

CAS 887407-34-3 is the registry number for Dimethyl 4-(4-aminophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Dimethyl 4-(4-aminophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate (CAS 887407-34-3) is a chemical compound with the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. IUPAC name: dimethyl 4-(4-aminophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate. InChIKey: CFSSPDUGIRSWFA-UHFFFAOYSA-N.

Identity
Molecular formulaC17H18N2O4
Molecular weight314.34 g/mol
IUPAC namedimethyl 4-(4-aminophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate
InChIKeyCFSSPDUGIRSWFA-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C(=N1)C)C(=O)OC)C2=CC=C(C=C2)N)C(=O)OC

Computed by PubChem (NCBI)