CAS 1261937-68-1 is the registry number for 5-(3-Carboxypyridin-2-yl)isophthalic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3-carboxy-2-pyridinyl)benzene-1,3-dicarboxylic acid (CAS 1261937-68-1) is a chemical compound with the molecular formula C14H9NO6 and a molecular weight of 287.22 g/mol. IUPAC name: 5-(3-carboxy-2-pyridinyl)benzene-1,3-dicarboxylic acid. InChIKey: AQRDRSNPWQWBOS-UHFFFAOYSA-N.
| Molecular formula | C14H9NO6 |
|---|---|
| Molecular weight | 287.22 g/mol |
| IUPAC name | 5-(3-carboxy-2-pyridinyl)benzene-1,3-dicarboxylic acid |
| InChIKey | AQRDRSNPWQWBOS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C2=CC(=CC(=C2)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)