Products 1261937-68-1

CAS 1261937-68-1 is the registry number for 5-(3-Carboxypyridin-2-yl)isophthalic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-(3-carboxy-2-pyridinyl)benzene-1,3-dicarboxylic acid (CAS 1261937-68-1) is a chemical compound with the molecular formula C14H9NO6 and a molecular weight of 287.22 g/mol. IUPAC name: 5-(3-carboxy-2-pyridinyl)benzene-1,3-dicarboxylic acid. InChIKey: AQRDRSNPWQWBOS-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9NO6
Molecular weight287.22 g/mol
IUPAC name5-(3-carboxy-2-pyridinyl)benzene-1,3-dicarboxylic acid
InChIKeyAQRDRSNPWQWBOS-UHFFFAOYSA-N
SMILESC1=CC(=C(N=C1)C2=CC(=CC(=C2)C(=O)O)C(=O)O)C(=O)O

Computed by PubChem (NCBI)