CAS 924831-72-1 is the registry number for Methyl 3-nitrooxanthrene-1-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl 3-nitrodibenzo-p-dioxin-1-carboxylate (CAS 924831-72-1) is a chemical compound with the molecular formula C14H9NO6 and a molecular weight of 287.22 g/mol. IUPAC name: methyl 3-nitrodibenzo-p-dioxin-1-carboxylate. InChIKey: PUPMDEODEBFKOQ-UHFFFAOYSA-N.
| Molecular formula | C14H9NO6 |
|---|---|
| Molecular weight | 287.22 g/mol |
| IUPAC name | methyl 3-nitrodibenzo-p-dioxin-1-carboxylate |
| InChIKey | PUPMDEODEBFKOQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC(=C1)[N+](=O)[O-])OC3=CC=CC=C3O2 |
Computed by PubChem (NCBI)