Products 3557-99-1
CAS 3557-99-1 appears in our catalog under these names: 1-(4-Nitrophenyl) 1,4-benzenedicarboxylate, 1-(4-Nitrophenyl) 1,4-Benzenedicarboxylate, >95% (HPLC). Offered by: Biosynth, TRC. Available pack sizes: 10mg, 25mg, 50mg, 5mg.
4-(4-nitrophenoxy)carbonylbenzoic acid (CAS 3557-99-1) is a chemical compound with the molecular formula C14H9NO6 and a molecular weight of 287.22 g/mol. IUPAC name: 4-(4-nitrophenoxy)carbonylbenzoic acid. InChIKey: LUQZCHUHDGHYOE-UHFFFAOYSA-N.
| Molecular formula | C14H9NO6 |
|---|---|
| Molecular weight | 287.22 g/mol |
| IUPAC name | 4-(4-nitrophenoxy)carbonylbenzoic acid |
| InChIKey | LUQZCHUHDGHYOE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)