CAS 47160-06-5 is the registry number for 3-Nitro-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-carboxyphenyl)-2-nitrobenzoic acid (CAS 47160-06-5) is a chemical compound with the molecular formula C14H9NO6 and a molecular weight of 287.22 g/mol. IUPAC name: 4-(4-carboxyphenyl)-2-nitrobenzoic acid. InChIKey: BEGHIOQRJAQQCF-UHFFFAOYSA-N.
| Molecular formula | C14H9NO6 |
|---|---|
| Molecular weight | 287.22 g/mol |
| IUPAC name | 4-(4-carboxyphenyl)-2-nitrobenzoic acid |
| InChIKey | BEGHIOQRJAQQCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)C(=O)O)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)