Products 47160-06-5

CAS 47160-06-5 is the registry number for 3-Nitro-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(4-carboxyphenyl)-2-nitrobenzoic acid (CAS 47160-06-5) is a chemical compound with the molecular formula C14H9NO6 and a molecular weight of 287.22 g/mol. IUPAC name: 4-(4-carboxyphenyl)-2-nitrobenzoic acid. InChIKey: BEGHIOQRJAQQCF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9NO6
Molecular weight287.22 g/mol
IUPAC name4-(4-carboxyphenyl)-2-nitrobenzoic acid
InChIKeyBEGHIOQRJAQQCF-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CC(=C(C=C2)C(=O)O)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)