Products 2619743-58-5

CAS 2619743-58-5 is the registry number for 2-(2-Carboxypyridin-4-yl)terephthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(2-carboxy-4-pyridinyl)terephthalic acid (CAS 2619743-58-5) is a chemical compound with the molecular formula C14H9NO6 and a molecular weight of 287.22 g/mol. IUPAC name: 2-(2-carboxy-4-pyridinyl)terephthalic acid. InChIKey: CUXJSVWWGCDDPV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9NO6
Molecular weight287.22 g/mol
IUPAC name2-(2-carboxy-4-pyridinyl)terephthalic acid
InChIKeyCUXJSVWWGCDDPV-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)C2=CC(=NC=C2)C(=O)O)C(=O)O

Computed by PubChem (NCBI)