Products 1261953-03-0
CAS 1261953-03-0 is the registry number for 3-(3-Methylphenyl)-5-nitrobenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-(3-methylphenyl)-5-nitrobenzoic acid (CAS 1261953-03-0) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 3-(3-methylphenyl)-5-nitrobenzoic acid. InChIKey: FRYFCZOBPJEQJY-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 3-(3-methylphenyl)-5-nitrobenzoic acid |
| InChIKey | FRYFCZOBPJEQJY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CC(=CC(=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3'-Methyl-5-nitro-[1,1'-biphenyl]-3-carboxylic acid, 3/'-Methyl-5-nitro-[1,1/'-biphenyl]-3-carboxylic acid, [1,1'-Biphenyl]-3-carboxylic acid, 3'-methyl-5-nitro-, 3'-Methyl-5-nitro-[1,1'-biphenyl]-3-carboxylicacid, 3-(m-tolyl)-5-nitro-benzoic acid, 3'-Methyl-5-nitro[1,1'-biphenyl]-3-carboxylic acid