Products 1261994-86-8
CAS 1261994-86-8 is the registry number for 5-(2,5-Dimethoxyphenyl)picolinic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
5-(2,5-dimethoxyphenyl)pyridine-2-carboxylic acid (CAS 1261994-86-8) is a chemical compound with the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. IUPAC name: 5-(2,5-dimethoxyphenyl)pyridine-2-carboxylic acid. InChIKey: GLHARYJNHKKWBK-UHFFFAOYSA-N.
| Molecular formula | C14H13NO4 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | 5-(2,5-dimethoxyphenyl)pyridine-2-carboxylic acid |
| InChIKey | GLHARYJNHKKWBK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C2=CN=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)