CAS 1262414-95-8 is the registry number for 1,1-Dimethylethyl 4-[(2,2,2-trifluoroacetyl)amino]benzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
Tert-butyl 4-[(2,2,2-trifluoroacetyl)amino]benzoate (CAS 1262414-95-8) is a chemical compound with the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. IUPAC name: tert-butyl 4-[(2,2,2-trifluoroacetyl)amino]benzoate. InChIKey: PJCWUZCWLLQYFT-UHFFFAOYSA-N.
| Molecular formula | C13H14F3NO3 |
|---|---|
| Molecular weight | 289.25 g/mol |
| IUPAC name | tert-butyl 4-[(2,2,2-trifluoroacetyl)amino]benzoate |
| InChIKey | PJCWUZCWLLQYFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(C=C1)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)