CAS 1263094-44-5 appears in our catalog under these names: 4-N-Boc-amino-isonipecotic acid methyl ester oxalic acid salt, 97%, Methyl 4-((tert-butoxycarbonyl)amino)piperidine-4-carboxylate oxalate, 95+%, 4-N-Boc-amino-piperidine-4-carboxylic acid methyl ester oxalate. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 5g, 1g.
Methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-4-carboxylate;oxalic acid (CAS 1263094-44-5) is a chemical compound with the molecular formula C14H24N2O8 and a molecular weight of 348.35 g/mol. IUPAC name: methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-4-carboxylate;oxalic acid. InChIKey: NFDLPOBMHWZKGP-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O8 |
|---|---|
| Molecular weight | 348.35 g/mol |
| IUPAC name | methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-4-carboxylate;oxalic acid |
| InChIKey | NFDLPOBMHWZKGP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCNCC1)C(=O)OC.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)