Products 1263094-44-5

CAS 1263094-44-5 appears in our catalog under these names: 4-N-Boc-amino-isonipecotic acid methyl ester oxalic acid salt, 97%, Methyl 4-((tert-butoxycarbonyl)amino)piperidine-4-carboxylate oxalate, 95+%, 4-N-Boc-amino-piperidine-4-carboxylic acid methyl ester oxalate. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-4-carboxylate;oxalic acid (CAS 1263094-44-5) is a chemical compound with the molecular formula C14H24N2O8 and a molecular weight of 348.35 g/mol. IUPAC name: methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-4-carboxylate;oxalic acid. InChIKey: NFDLPOBMHWZKGP-UHFFFAOYSA-N.

Identity
Molecular formulaC14H24N2O8
Molecular weight348.35 g/mol
IUPAC namemethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-4-carboxylate;oxalic acid
InChIKeyNFDLPOBMHWZKGP-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1(CCNCC1)C(=O)OC.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)